C15H22BrNO2 — CID 55099046
1-(3-bromophenyl)-3-(2,5-dimethylmorpholin-4-yl)propan-1-ol (PubChem CID 55099046) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,5-dimethylmorpholin-4-yl)propan-1-ol.
| Compound Name | 1-(3-bromophenyl)-3-(2,5-dimethylmorpholin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 55099046 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,5-dimethylmorpholin-4-yl)propan-1-ol |
| SMILES | CC1CN(CCC(O)c2cccc(Br)c2)C(C)CO1 |
| InChI | InChI=1S/C15H22BrNO2/c1-11-10-19-12(2)9-17(11)7-6-15(18)13-4-3-5-14(16)8-13/h3-5,8,11-12,15,18H,6-7,9-10H2,1-2H3 |
| InChIKey | MVRIBHXUVRRAKU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |