C13H16BrNO2 — CID 43420926
(3-bromophenyl)-(2,5-dimethylmorpholin-4-yl)methanone (PubChem CID 43420926) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is (3-bromophenyl)-(2,5-dimethylmorpholin-4-yl)methanone.
| Compound Name | (3-bromophenyl)-(2,5-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 43420926 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (3-bromophenyl)-(2,5-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2cccc(Br)c2)C(C)CO1 |
| InChI | InChI=1S/C13H16BrNO2/c1-9-8-17-10(2)7-15(9)13(16)11-4-3-5-12(14)6-11/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | SCJKTEZGILFBEF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |