C14H17N3O2 — CID 43420928
3H-benzimidazol-5-yl-(2,5-dimethylmorpholin-4-yl)methanone (PubChem CID 43420928) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-(2,5-dimethylmorpholin-4-yl)methanone.
| Compound Name | 3H-benzimidazol-5-yl-(2,5-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 43420928 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3H-benzimidazol-5-yl-(2,5-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc3nc[nH]c3c2)C(C)CO1 |
| InChI | InChI=1S/C14H17N3O2/c1-9-7-19-10(2)6-17(9)14(18)11-3-4-12-13(5-11)16-8-15-12/h3-5,8-10H,6-7H2,1-2H3,(H,15,16) |
| InChIKey | HWKJMAIQABQNOQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |