C12H16N2O2 — CID 110727642
(2,5-dimethylmorpholin-4-yl)-pyridin-3-ylmethanone (PubChem CID 110727642) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2,5-dimethylmorpholin-4-yl)-pyridin-3-ylmethanone.
| Compound Name | (2,5-dimethylmorpholin-4-yl)-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 110727642 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2,5-dimethylmorpholin-4-yl)-pyridin-3-ylmethanone |
| SMILES | CC1CN(C(=O)c2cccnc2)C(C)CO1 |
| InChI | InChI=1S/C12H16N2O2/c1-9-8-16-10(2)7-14(9)12(15)11-4-3-5-13-6-11/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | AQYGCFGNSLWOFV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |