C19H20BrNO2 — CID 110644011
(2-benzyl-5-methylmorpholin-4-yl)-(3-bromophenyl)methanone (PubChem CID 110644011) has the molecular formula C19H20BrNO2 and a molecular weight of 374.28 g/mol. Its IUPAC name is (2-benzyl-5-methylmorpholin-4-yl)-(3-bromophenyl)methanone.
| Compound Name | (2-benzyl-5-methylmorpholin-4-yl)-(3-bromophenyl)methanone |
|---|---|
| PubChem CID | 110644011 |
| Molecular Formula | C19H20BrNO2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (2-benzyl-5-methylmorpholin-4-yl)-(3-bromophenyl)methanone |
| SMILES | CC1COC(Cc2ccccc2)CN1C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H20BrNO2/c1-14-13-23-18(10-15-6-3-2-4-7-15)12-21(14)19(22)16-8-5-9-17(20)11-16/h2-9,11,14,18H,10,12-13H2,1H3 |
| InChIKey | LSWUVIZPDOJRSG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |