C14H26N2O2 — CID 94066325
2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide (PubChem CID 94066325) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide.
| Compound Name | 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 94066325 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
| SMILES | C=C(C)CN(CC)C(=O)CN1C[C@@H](C)OC[C@@H]1C |
| InChI | InChI=1S/C14H26N2O2/c1-6-15(7-11(2)3)14(17)9-16-8-13(5)18-10-12(16)4/h12-13H,2,6-10H2,1,3-5H3/t12-,13+/m0/s1 |
| InChIKey | GJQYUCKWVVQIDB-QWHCGFSZSA-N |
| XLogP | 1.52 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|