C8H16ClNO — CID 53215608
(2R,6S)-4-(2-chloroethyl)-2,6-dimethylmorpholine (PubChem CID 53215608) has the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. Its IUPAC name is (2R,6S)-4-(2-chloroethyl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-(2-chloroethyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 53215608 |
| Molecular Formula | C8H16ClNO |
| Molecular Weight | 177.67 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | (2R,6S)-4-(2-chloroethyl)-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(CCCl)C[C@H](C)O1 |
| InChI | InChI=1S/C8H16ClNO/c1-7-5-10(4-3-9)6-8(2)11-7/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | GSCDLDXSKMWJMV-OCAPTIKFSA-N |
| XLogP | 1.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.67 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|