C7H15NOS — CID 90819554
(2,6-dimethylmorpholin-4-yl)methanethiol (PubChem CID 90819554) has the molecular formula C7H15NOS and a molecular weight of 161.27 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)methanethiol.
| Compound Name | (2,6-dimethylmorpholin-4-yl)methanethiol |
|---|---|
| PubChem CID | 90819554 |
| Molecular Formula | C7H15NOS |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)methanethiol |
| SMILES | CC1CN(CS)CC(C)O1 |
| InChI | InChI=1S/C7H15NOS/c1-6-3-8(5-10)4-7(2)9-6/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | UNUBXYQAWTWRMT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|