C11H23NO — CID 148863425
(2R,6S)-4-(2,2-dimethylpropyl)-2,6-dimethylmorpholine (PubChem CID 148863425) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is (2R,6S)-4-(2,2-dimethylpropyl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-(2,2-dimethylpropyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 148863425 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (2R,6S)-4-(2,2-dimethylpropyl)-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(CC(C)(C)C)C[C@H](C)O1 |
| InChI | InChI=1S/C11H23NO/c1-9-6-12(7-10(2)13-9)8-11(3,4)5/h9-10H,6-8H2,1-5H3/t9-,10+ |
| InChIKey | OZTSFMKPRMTWFB-AOOOYVTPSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |