3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid

C11H21NO3 — CID 22683272

IUPAC3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid
SMILESCC1CN(CC(C)(C)C(=O)O)CC(C)O1
InChIInChI=1S/C11H21NO3/c1-8-5-12(6-9(2)15-8)7-11(3,4)10(13)14/h8-9H,5-7H2,1-4H3,(H,13,14)
InChIKeyKBKRCKGDEAKBAI-UHFFFAOYSA-N
MW215.29 g/mol
LogP1.21
Rot. Bonds3

About 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid

3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid (PubChem CID 22683272) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid
PubChem CID22683272
Molecular FormulaC11H21NO3
Molecular Weight215.29 g/mol
Exact Mass215.15
IUPAC Name3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid
SMILESCC1CN(CC(C)(C)C(=O)O)CC(C)O1
InChIInChI=1S/C11H21NO3/c1-8-5-12(6-9(2)15-8)7-11(3,4)10(13)14/h8-9H,5-7H2,1-4H3,(H,13,14)
InChIKeyKBKRCKGDEAKBAI-UHFFFAOYSA-N
XLogP1.21
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.29
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid (CID 22683272) is 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid is CC1CN(CC(C)(C)C(=O)O)CC(C)O1.
What is the InChIKey of 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid?
The InChIKey is KBKRCKGDEAKBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-8-5-12(6-9(2)15-8)7-11(3,4)10(13)14/h8-9H,5-7H2,1-4H3,(H,13,14).
What are the key properties of 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid?
3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid has a molecular weight of 215.29 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 22683272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).