C11H20ClNO2 — CID 82041291
3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoyl chloride (PubChem CID 82041291) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoyl chloride.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoyl chloride |
|---|---|
| PubChem CID | 82041291 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-2,2-dimethylpropanoyl chloride |
| SMILES | CC1CN(CC(C)(C)C(=O)Cl)CC(C)O1 |
| InChI | InChI=1S/C11H20ClNO2/c1-8-5-13(6-9(2)15-8)7-11(3,4)10(12)14/h8-9H,5-7H2,1-4H3 |
| InChIKey | SQZKSZGOVCPYJQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|