C12H25NO2 — CID 103936738
3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]pentan-3-ol (PubChem CID 103936738) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]pentan-3-ol.
| Compound Name | 3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 103936738 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H25NO2/c1-5-12(14,6-2)9-13-7-10(3)15-11(4)8-13/h10-11,14H,5-9H2,1-4H3/t10-,11+ |
| InChIKey | KYZQCGXYAYVRDS-PHIMTYICSA-N |
| XLogP | 1.65 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |