C12H25NO2 — CID 66452172
4-(2,6-dimethylmorpholin-4-yl)-3,3-dimethylbutan-2-ol (PubChem CID 66452172) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)-3,3-dimethylbutan-2-ol.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 66452172 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)-3,3-dimethylbutan-2-ol |
| SMILES | CC1CN(CC(C)(C)C(C)O)CC(C)O1 |
| InChI | InChI=1S/C12H25NO2/c1-9-6-13(7-10(2)15-9)8-12(4,5)11(3)14/h9-11,14H,6-8H2,1-5H3 |
| InChIKey | XFLBZPGJKMDQNV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |