C7H12ClNO2 — CID 19080228
2,6-dimethylmorpholine-4-carbonyl chloride (PubChem CID 19080228) has the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. Its IUPAC name is 2,6-dimethylmorpholine-4-carbonyl chloride.
| Compound Name | 2,6-dimethylmorpholine-4-carbonyl chloride |
|---|---|
| PubChem CID | 19080228 |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2,6-dimethylmorpholine-4-carbonyl chloride |
| SMILES | CC1CN(C(=O)Cl)CC(C)O1 |
| InChI | InChI=1S/C7H12ClNO2/c1-5-3-9(7(8)10)4-6(2)11-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | ROBIABICEDEGND-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|