C8H16NO2S+ — CID 153278899
[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]sulfanium (PubChem CID 153278899) has the molecular formula C8H16NO2S+ and a molecular weight of 190.29 g/mol. Its IUPAC name is [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]sulfanium.
| Compound Name | [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]sulfanium |
|---|---|
| PubChem CID | 153278899 |
| Molecular Formula | C8H16NO2S+ |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]sulfanium |
| SMILES | C[C@@H]1CN(C(=O)C[SH2+])C[C@H](C)O1 |
| InChI | InChI=1S/C8H15NO2S/c1-6-3-9(8(10)5-12)4-7(2)11-6/h6-7,12H,3-5H2,1-2H3/p+1/t6-,7+ |
| InChIKey | IGDGGGVFQIRAMZ-KNVOCYPGSA-O |
| XLogP | -0.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|