C8H14BrNO2 — CID 53216148
2-bromo-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone (PubChem CID 53216148) has the molecular formula C8H14BrNO2 and a molecular weight of 236.11 g/mol. Its IUPAC name is 2-bromo-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone.
| Compound Name | 2-bromo-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 53216148 |
| Molecular Formula | C8H14BrNO2 |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-bromo-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)CBr)C[C@H](C)O1 |
| InChI | InChI=1S/C8H14BrNO2/c1-6-4-10(8(11)3-9)5-7(2)12-6/h6-7H,3-5H2,1-2H3/t6-,7+ |
| InChIKey | XMYVYNBQHMXEDC-KNVOCYPGSA-N |
| XLogP | 1.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|