(2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid

C7H13NO3 — CID 137442866

IUPAC(2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid
SMILESC[C@H]1CN(C(=O)O)C[C@H](C)O1
InChIInChI=1S/C7H13NO3/c1-5-3-8(7(9)10)4-6(2)11-5/h5-6H,3-4H2,1-2H3,(H,9,10)/t5-,6-/m0/s1
InChIKeyRGWNKCUDJZLQOK-WDSKDSINSA-N
MW159.18 g/mol
LogP0.77
Rot. Bonds

About (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid

(2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid (PubChem CID 137442866) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid.

Molecular Properties

Compound Name(2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid
PubChem CID137442866
Molecular FormulaC7H13NO3
Molecular Weight159.18 g/mol
Exact Mass159.09
IUPAC Name(2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid
SMILESC[C@H]1CN(C(=O)O)C[C@H](C)O1
InChIInChI=1S/C7H13NO3/c1-5-3-8(7(9)10)4-6(2)11-5/h5-6H,3-4H2,1-2H3,(H,9,10)/t5-,6-/m0/s1
InChIKeyRGWNKCUDJZLQOK-WDSKDSINSA-N
XLogP0.77
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.18
LogP ≤ 50.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid?
The IUPAC name of (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid (CID 137442866) is (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid.
What is the SMILES notation for (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid?
The canonical SMILES for (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid is C[C@H]1CN(C(=O)O)C[C@H](C)O1.
What is the InChIKey of (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid?
The InChIKey is RGWNKCUDJZLQOK-WDSKDSINSA-N. The full InChI is InChI=1S/C7H13NO3/c1-5-3-8(7(9)10)4-6(2)11-5/h5-6H,3-4H2,1-2H3,(H,9,10)/t5-,6-/m0/s1.
What are the key properties of (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid?
(2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid has a molecular weight of 159.18 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid is sourced from PubChem (CID 137442866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).