C7H13NO3 — CID 137442866
(2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid (PubChem CID 137442866) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid.
| Compound Name | (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 137442866 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2S,6S)-2,6-dimethylmorpholine-4-carboxylic acid |
| SMILES | C[C@H]1CN(C(=O)O)C[C@H](C)O1 |
| InChI | InChI=1S/C7H13NO3/c1-5-3-8(7(9)10)4-6(2)11-5/h5-6H,3-4H2,1-2H3,(H,9,10)/t5-,6-/m0/s1 |
| InChIKey | RGWNKCUDJZLQOK-WDSKDSINSA-N |
| XLogP | 0.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |