C8H15NO2 — CID 3361054
1-(2,6-dimethylmorpholin-4-yl)ethanone (PubChem CID 3361054) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 1-(2,6-dimethylmorpholin-4-yl)ethanone.
| Compound Name | 1-(2,6-dimethylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 3361054 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 1-(2,6-dimethylmorpholin-4-yl)ethanone |
| SMILES | CC(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C8H15NO2/c1-6-4-9(8(3)10)5-7(2)11-6/h6-7H,4-5H2,1-3H3 |
| InChIKey | ITBIIJTXOBWJPI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |