C9H17NO2 — CID 146290513
1-(2,7-dimethyl-1,4-oxazepan-4-yl)ethanone (PubChem CID 146290513) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-(2,7-dimethyl-1,4-oxazepan-4-yl)ethanone.
| Compound Name | 1-(2,7-dimethyl-1,4-oxazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 146290513 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 1-(2,7-dimethyl-1,4-oxazepan-4-yl)ethanone |
| SMILES | CC(=O)N1CCC(C)OC(C)C1 |
| InChI | InChI=1S/C9H17NO2/c1-7-4-5-10(9(3)11)6-8(2)12-7/h7-8H,4-6H2,1-3H3 |
| InChIKey | VFEYOAYVJSDWBD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |