C8H15NO2 — CID 129394019
1-[(3S,4R)-4-hydroxy-3-methylpiperidin-1-yl]ethanone (PubChem CID 129394019) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 1-[(3S,4R)-4-hydroxy-3-methylpiperidin-1-yl]ethanone.
| Compound Name | 1-[(3S,4R)-4-hydroxy-3-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 129394019 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 1-[(3S,4R)-4-hydroxy-3-methylpiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@@H](O)[C@@H](C)C1 |
| InChI | InChI=1S/C8H15NO2/c1-6-5-9(7(2)10)4-3-8(6)11/h6,8,11H,3-5H2,1-2H3/t6-,8+/m0/s1 |
| InChIKey | ZKWIABBWJNENHE-POYBYMJQSA-N |
| XLogP | 0.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |