C8H15NO2S — CID 114683823
1-(4-hydroxy-3-methylpiperidin-1-yl)-2-sulfanylethanone (PubChem CID 114683823) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methylpiperidin-1-yl)-2-sulfanylethanone.
| Compound Name | 1-(4-hydroxy-3-methylpiperidin-1-yl)-2-sulfanylethanone |
|---|---|
| PubChem CID | 114683823 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 1-(4-hydroxy-3-methylpiperidin-1-yl)-2-sulfanylethanone |
| SMILES | CC1CN(C(=O)CS)CCC1O |
| InChI | InChI=1S/C8H15NO2S/c1-6-4-9(8(11)5-12)3-2-7(6)10/h6-7,10,12H,2-5H2,1H3 |
| InChIKey | FRDXOYMCYFLUOP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|