C9H15NO4 — CID 164644909
2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid (PubChem CID 164644909) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid.
| Compound Name | 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 164644909 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid |
| SMILES | CC1CCN(C(=O)C(=O)O)CC(C)O1 |
| InChI | InChI=1S/C9H15NO4/c1-6-3-4-10(5-7(2)14-6)8(11)9(12)13/h6-7H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | RDQPKHCVEGDTPU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|