2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid

C9H15NO4 — CID 164644909

IUPAC2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid
SMILESCC1CCN(C(=O)C(=O)O)CC(C)O1
InChIInChI=1S/C9H15NO4/c1-6-3-4-10(5-7(2)14-6)8(11)9(12)13/h6-7H,3-5H2,1-2H3,(H,12,13)
InChIKeyRDQPKHCVEGDTPU-UHFFFAOYSA-N
MW201.22 g/mol
LogP0.10
Rot. Bonds

About 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid

2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid (PubChem CID 164644909) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid
PubChem CID164644909
Molecular FormulaC9H15NO4
Molecular Weight201.22 g/mol
Exact Mass201.10
IUPAC Name2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid
SMILESCC1CCN(C(=O)C(=O)O)CC(C)O1
InChIInChI=1S/C9H15NO4/c1-6-3-4-10(5-7(2)14-6)8(11)9(12)13/h6-7H,3-5H2,1-2H3,(H,12,13)
InChIKeyRDQPKHCVEGDTPU-UHFFFAOYSA-N
XLogP0.10
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.22
LogP ≤ 50.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid?
The IUPAC name of 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid (CID 164644909) is 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid is CC1CCN(C(=O)C(=O)O)CC(C)O1.
What is the InChIKey of 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid?
The InChIKey is RDQPKHCVEGDTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c1-6-3-4-10(5-7(2)14-6)8(11)9(12)13/h6-7H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid?
2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid has a molecular weight of 201.22 g/mol, XLogP of 0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,7-dimethyl-1,4-oxazepan-4-yl)-2-oxoacetic acid is sourced from PubChem (CID 164644909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).