C8H15ClN2O — CID 131028451
(3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride (PubChem CID 131028451) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride.
| Compound Name | (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride |
|---|---|
| PubChem CID | 131028451 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride |
| SMILES | C[C@@H]1CN(C(=O)Cl)C[C@H](C)N1C |
| InChI | InChI=1S/C8H15ClN2O/c1-6-4-11(8(9)12)5-7(2)10(6)3/h6-7H,4-5H2,1-3H3/t6-,7+ |
| InChIKey | QEEPYQADBQELFR-KNVOCYPGSA-N |
| XLogP | 1.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|