(3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride

C8H15ClN2O — CID 131028451

IUPAC(3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride
SMILESC[C@@H]1CN(C(=O)Cl)C[C@H](C)N1C
InChIInChI=1S/C8H15ClN2O/c1-6-4-11(8(9)12)5-7(2)10(6)3/h6-7H,4-5H2,1-3H3/t6-,7+
InChIKeyQEEPYQADBQELFR-KNVOCYPGSA-N
MW190.67 g/mol
LogP1.37
Rot. Bonds

About (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride

(3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride (PubChem CID 131028451) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride.

Molecular Properties

Compound Name(3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride
PubChem CID131028451
Molecular FormulaC8H15ClN2O
Molecular Weight190.67 g/mol
Exact Mass190.09
IUPAC Name(3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride
SMILESC[C@@H]1CN(C(=O)Cl)C[C@H](C)N1C
InChIInChI=1S/C8H15ClN2O/c1-6-4-11(8(9)12)5-7(2)10(6)3/h6-7H,4-5H2,1-3H3/t6-,7+
InChIKeyQEEPYQADBQELFR-KNVOCYPGSA-N
XLogP1.37
TPSA23.55 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.67
LogP ≤ 51.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride?
The IUPAC name of (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride (CID 131028451) is (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride.
What is the SMILES notation for (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride?
The canonical SMILES for (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride is C[C@@H]1CN(C(=O)Cl)C[C@H](C)N1C.
What is the InChIKey of (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride?
The InChIKey is QEEPYQADBQELFR-KNVOCYPGSA-N. The full InChI is InChI=1S/C8H15ClN2O/c1-6-4-11(8(9)12)5-7(2)10(6)3/h6-7H,4-5H2,1-3H3/t6-,7+.
What are the key properties of (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride?
(3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride has a molecular weight of 190.67 g/mol, XLogP of 1.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-3,4,5-trimethylpiperazine-1-carbonyl chloride is sourced from PubChem (CID 131028451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).