C10H16N2O — CID 130702966
1-(3,4,5-trimethylpiperazin-1-yl)prop-2-yn-1-one (PubChem CID 130702966) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(3,4,5-trimethylpiperazin-1-yl)prop-2-yn-1-one.
| Compound Name | 1-(3,4,5-trimethylpiperazin-1-yl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 130702966 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(3,4,5-trimethylpiperazin-1-yl)prop-2-yn-1-one |
| SMILES | C#CC(=O)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C10H16N2O/c1-5-10(13)12-6-8(2)11(4)9(3)7-12/h1,8-9H,6-7H2,2-4H3 |
| InChIKey | REMLTZOFZQZHFE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|