C11H21N3O3 — CID 104937472
(2R)-2-[(3,4,5-trimethylpiperazine-1-carbonyl)amino]propanoic acid (PubChem CID 104937472) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is (2R)-2-[(3,4,5-trimethylpiperazine-1-carbonyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(3,4,5-trimethylpiperazine-1-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 104937472 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (2R)-2-[(3,4,5-trimethylpiperazine-1-carbonyl)amino]propanoic acid |
| SMILES | CC1CN(C(=O)N[C@H](C)C(=O)O)CC(C)N1C |
| InChI | InChI=1S/C11H21N3O3/c1-7-5-14(6-8(2)13(7)4)11(17)12-9(3)10(15)16/h7-9H,5-6H2,1-4H3,(H,12,17)(H,15,16)/t7?,8?,9-/m1/s1 |
| InChIKey | VMEOMZWPBZOBAU-AMDVSUOASA-N |
| XLogP | 0.19 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |