C13H23N3O5 — CID 114538855
2-[(3,4,5-trimethylpiperazine-1-carbonyl)amino]pentanedioic acid (PubChem CID 114538855) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[(3,4,5-trimethylpiperazine-1-carbonyl)amino]pentanedioic acid.
| Compound Name | 2-[(3,4,5-trimethylpiperazine-1-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 114538855 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-[(3,4,5-trimethylpiperazine-1-carbonyl)amino]pentanedioic acid |
| SMILES | CC1CN(C(=O)NC(CCC(=O)O)C(=O)O)CC(C)N1C |
| InChI | InChI=1S/C13H23N3O5/c1-8-6-16(7-9(2)15(8)3)13(21)14-10(12(19)20)4-5-11(17)18/h8-10H,4-7H2,1-3H3,(H,14,21)(H,17,18)(H,19,20) |
| InChIKey | HSTJOKFLGKZBPG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |