C12H21N3O5 — CID 63605099
2-[(3,4-dimethylpiperazine-1-carbonyl)amino]pentanedioic acid (PubChem CID 63605099) has the molecular formula C12H21N3O5 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-[(3,4-dimethylpiperazine-1-carbonyl)amino]pentanedioic acid.
| Compound Name | 2-[(3,4-dimethylpiperazine-1-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 63605099 |
| Molecular Formula | C12H21N3O5 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[(3,4-dimethylpiperazine-1-carbonyl)amino]pentanedioic acid |
| SMILES | CC1CN(C(=O)NC(CCC(=O)O)C(=O)O)CCN1C |
| InChI | InChI=1S/C12H21N3O5/c1-8-7-15(6-5-14(8)2)12(20)13-9(11(18)19)3-4-10(16)17/h8-9H,3-7H2,1-2H3,(H,13,20)(H,16,17)(H,18,19) |
| InChIKey | XQHVOJMXYITPBO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |