C13H24N4O4 — CID 63615693
(2S)-5-amino-2-[(3-ethyl-4-methylpiperazine-1-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 63615693) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is (2S)-5-amino-2-[(3-ethyl-4-methylpiperazine-1-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(3-ethyl-4-methylpiperazine-1-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 63615693 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (2S)-5-amino-2-[(3-ethyl-4-methylpiperazine-1-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | CCC1CN(C(=O)N[C@@H](CCC(N)=O)C(=O)O)CCN1C |
| InChI | InChI=1S/C13H24N4O4/c1-3-9-8-17(7-6-16(9)2)13(21)15-10(12(19)20)4-5-11(14)18/h9-10H,3-8H2,1-2H3,(H2,14,18)(H,15,21)(H,19,20)/t9?,10-/m0/s1 |
| InChIKey | CAXLGNAZRJARSI-AXDSSHIGSA-N |
| XLogP | -0.56 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |