C11H20N4O4 — CID 107830632
(2R)-5-amino-2-[(3-aminopiperidine-1-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 107830632) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is (2R)-5-amino-2-[(3-aminopiperidine-1-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[(3-aminopiperidine-1-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107830632 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (2R)-5-amino-2-[(3-aminopiperidine-1-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](NC(=O)N1CCCC(N)C1)C(=O)O |
| InChI | InChI=1S/C11H20N4O4/c12-7-2-1-5-15(6-7)11(19)14-8(10(17)18)3-4-9(13)16/h7-8H,1-6,12H2,(H2,13,16)(H,14,19)(H,17,18)/t7?,8-/m1/s1 |
| InChIKey | GDYNYRGPGQDNKR-BRFYHDHCSA-N |
| XLogP | -1.16 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |