C10H17N3O5 — CID 55029823
2-[(3-aminopyrrolidine-1-carbonyl)amino]pentanedioic acid (PubChem CID 55029823) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[(3-aminopyrrolidine-1-carbonyl)amino]pentanedioic acid.
| Compound Name | 2-[(3-aminopyrrolidine-1-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 55029823 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-[(3-aminopyrrolidine-1-carbonyl)amino]pentanedioic acid |
| SMILES | NC1CCN(C(=O)NC(CCC(=O)O)C(=O)O)C1 |
| InChI | InChI=1S/C10H17N3O5/c11-6-3-4-13(5-6)10(18)12-7(9(16)17)1-2-8(14)15/h6-7H,1-5,11H2,(H,12,18)(H,14,15)(H,16,17) |
| InChIKey | UVYCNEQTMMJAMU-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |