C12H20N2O7 — CID 103536379
2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanedioic acid (PubChem CID 103536379) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanedioic acid.
| Compound Name | 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 103536379 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanedioic acid |
| SMILES | COC1CN(C(=O)NC(CCC(=O)O)C(=O)O)CC1OC |
| InChI | InChI=1S/C12H20N2O7/c1-20-8-5-14(6-9(8)21-2)12(19)13-7(11(17)18)3-4-10(15)16/h7-9H,3-6H2,1-2H3,(H,13,19)(H,15,16)(H,17,18) |
| InChIKey | PRGHILPBPDUFOH-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |