2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid

C12H22N2O5 — CID 103536440

IUPAC2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid
SMILESCCCC(NC(=O)N1CC(OC)C(OC)C1)C(=O)O
InChIInChI=1S/C12H22N2O5/c1-4-5-8(11(15)16)13-12(17)14-6-9(18-2)10(7-14)19-3/h8-10H,4-7H2,1-3H3,(H,13,17)(H,15,16)
InChIKeyNQLGVNIAYJXKIC-UHFFFAOYSA-N
MW274.32 g/mol
LogP0.29
Rot. Bonds6

About 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid

2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid (PubChem CID 103536440) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid.

Molecular Properties

Compound Name2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid
PubChem CID103536440
Molecular FormulaC12H22N2O5
Molecular Weight274.32 g/mol
Exact Mass274.15
IUPAC Name2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid
SMILESCCCC(NC(=O)N1CC(OC)C(OC)C1)C(=O)O
InChIInChI=1S/C12H22N2O5/c1-4-5-8(11(15)16)13-12(17)14-6-9(18-2)10(7-14)19-3/h8-10H,4-7H2,1-3H3,(H,13,17)(H,15,16)
InChIKeyNQLGVNIAYJXKIC-UHFFFAOYSA-N
XLogP0.29
TPSA88.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.32
LogP ≤ 50.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid?
The IUPAC name of 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid (CID 103536440) is 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid.
What is the SMILES notation for 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid?
The canonical SMILES for 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid is CCCC(NC(=O)N1CC(OC)C(OC)C1)C(=O)O.
What is the InChIKey of 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid?
The InChIKey is NQLGVNIAYJXKIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O5/c1-4-5-8(11(15)16)13-12(17)14-6-9(18-2)10(7-14)19-3/h8-10H,4-7H2,1-3H3,(H,13,17)(H,15,16).
What are the key properties of 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid?
2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid has a molecular weight of 274.32 g/mol, XLogP of 0.29, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid is sourced from PubChem (CID 103536440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).