C12H22N2O5 — CID 107567836
(2R)-2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid (PubChem CID 107567836) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2R)-2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid.
| Compound Name | (2R)-2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 107567836 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (2R)-2-[(3,4-dimethoxypyrrolidine-1-carbonyl)amino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)N1CC(OC)C(OC)C1)C(=O)O |
| InChI | InChI=1S/C12H22N2O5/c1-4-5-8(11(15)16)13-12(17)14-6-9(18-2)10(7-14)19-3/h8-10H,4-7H2,1-3H3,(H,13,17)(H,15,16)/t8-,9?,10?/m1/s1 |
| InChIKey | NQLGVNIAYJXKIC-XNWIYYODSA-N |
| XLogP | 0.29 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |