C12H20N2O5 — CID 61187712
(2S)-2-[(2-methylpiperidine-1-carbonyl)amino]pentanedioic acid (PubChem CID 61187712) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2S)-2-[(2-methylpiperidine-1-carbonyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(2-methylpiperidine-1-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 61187712 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2S)-2-[(2-methylpiperidine-1-carbonyl)amino]pentanedioic acid |
| SMILES | CC1CCCCN1C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20N2O5/c1-8-4-2-3-7-14(8)12(19)13-9(11(17)18)5-6-10(15)16/h8-9H,2-7H2,1H3,(H,13,19)(H,15,16)(H,17,18)/t8?,9-/m0/s1 |
| InChIKey | VHCUJKGUIJBSSL-GKAPJAKFSA-N |
| XLogP | 0.89 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |