C13H22N2O5 — CID 107838651
(2R)-2-[(2-ethylpyrrolidine-1-carbonyl)amino]hexanedioic acid (PubChem CID 107838651) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2R)-2-[(2-ethylpyrrolidine-1-carbonyl)amino]hexanedioic acid.
| Compound Name | (2R)-2-[(2-ethylpyrrolidine-1-carbonyl)amino]hexanedioic acid |
|---|---|
| PubChem CID | 107838651 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (2R)-2-[(2-ethylpyrrolidine-1-carbonyl)amino]hexanedioic acid |
| SMILES | CCC1CCCN1C(=O)N[C@H](CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H22N2O5/c1-2-9-5-4-8-15(9)13(20)14-10(12(18)19)6-3-7-11(16)17/h9-10H,2-8H2,1H3,(H,14,20)(H,16,17)(H,18,19)/t9?,10-/m1/s1 |
| InChIKey | OGUKJUWMSUKYMY-QVDQXJPCSA-N |
| XLogP | 1.28 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |