C12H21N3O — CID 114536814
2-amino-1-(3,4,5-trimethylpiperazin-1-yl)pent-4-yn-1-one (PubChem CID 114536814) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-amino-1-(3,4,5-trimethylpiperazin-1-yl)pent-4-yn-1-one.
| Compound Name | 2-amino-1-(3,4,5-trimethylpiperazin-1-yl)pent-4-yn-1-one |
|---|---|
| PubChem CID | 114536814 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-amino-1-(3,4,5-trimethylpiperazin-1-yl)pent-4-yn-1-one |
| SMILES | C#CCC(N)C(=O)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C12H21N3O/c1-5-6-11(13)12(16)15-7-9(2)14(4)10(3)8-15/h1,9-11H,6-8,13H2,2-4H3 |
| InChIKey | SWIXMSXHNUHSHE-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|