C11H23N3O — CID 114536651
2-(ethylamino)-1-(3,4,5-trimethylpiperazin-1-yl)ethanone (PubChem CID 114536651) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(ethylamino)-1-(3,4,5-trimethylpiperazin-1-yl)ethanone.
| Compound Name | 2-(ethylamino)-1-(3,4,5-trimethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 114536651 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 2-(ethylamino)-1-(3,4,5-trimethylpiperazin-1-yl)ethanone |
| SMILES | CCNCC(=O)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C11H23N3O/c1-5-12-6-11(15)14-7-9(2)13(4)10(3)8-14/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | SHMYRVNGRVXZSI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |