C10H20N2O3 — CID 103533144
1-(3,4-dimethoxypyrrolidin-1-yl)-2-(ethylamino)ethanone (PubChem CID 103533144) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(3,4-dimethoxypyrrolidin-1-yl)-2-(ethylamino)ethanone.
| Compound Name | 1-(3,4-dimethoxypyrrolidin-1-yl)-2-(ethylamino)ethanone |
|---|---|
| PubChem CID | 103533144 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-(3,4-dimethoxypyrrolidin-1-yl)-2-(ethylamino)ethanone |
| SMILES | CCNCC(=O)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C10H20N2O3/c1-4-11-5-10(13)12-6-8(14-2)9(7-12)15-3/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | SGKRUWQCMNPHBQ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |