C7H15N3O3 — CID 103536753
3,4-dimethoxypyrrolidine-1-carbohydrazide (PubChem CID 103536753) has the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 3,4-dimethoxypyrrolidine-1-carbohydrazide.
| Compound Name | 3,4-dimethoxypyrrolidine-1-carbohydrazide |
|---|---|
| PubChem CID | 103536753 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 3,4-dimethoxypyrrolidine-1-carbohydrazide |
| SMILES | COC1CN(C(=O)NN)CC1OC |
| InChI | InChI=1S/C7H15N3O3/c1-12-5-3-10(7(11)9-8)4-6(5)13-2/h5-6H,3-4,8H2,1-2H3,(H,9,11) |
| InChIKey | PNQKWUUGJBOEOW-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|