C12H22N2O3 — CID 103532063
(3,4-dimethoxypyrrolidin-1-yl)-piperidin-1-ylmethanone (PubChem CID 103532063) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is (3,4-dimethoxypyrrolidin-1-yl)-piperidin-1-ylmethanone.
| Compound Name | (3,4-dimethoxypyrrolidin-1-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 103532063 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (3,4-dimethoxypyrrolidin-1-yl)-piperidin-1-ylmethanone |
| SMILES | COC1CN(C(=O)N2CCCCC2)CC1OC |
| InChI | InChI=1S/C12H22N2O3/c1-16-10-8-14(9-11(10)17-2)12(15)13-6-4-3-5-7-13/h10-11H,3-9H2,1-2H3 |
| InChIKey | FIGJPVOCMRPQQH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |