(3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid

C7H13NO4 — CID 20745982

IUPAC(3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid
SMILESCO[C@H]1CN(C(=O)O)C[C@H]1OC
InChIInChI=1S/C7H13NO4/c1-11-5-3-8(7(9)10)4-6(5)12-2/h5-6H,3-4H2,1-2H3,(H,9,10)/t5-,6+
InChIKeyPXCNTHIZLLJSKA-OLQVQODUSA-N
MW175.18 g/mol
LogP0.01
Rot. Bonds2

About (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid

(3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid (PubChem CID 20745982) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid.

Molecular Properties

Compound Name(3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid
PubChem CID20745982
Molecular FormulaC7H13NO4
Molecular Weight175.18 g/mol
Exact Mass175.08
IUPAC Name(3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid
SMILESCO[C@H]1CN(C(=O)O)C[C@H]1OC
InChIInChI=1S/C7H13NO4/c1-11-5-3-8(7(9)10)4-6(5)12-2/h5-6H,3-4H2,1-2H3,(H,9,10)/t5-,6+
InChIKeyPXCNTHIZLLJSKA-OLQVQODUSA-N
XLogP0.01
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.18
LogP ≤ 50.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid?
The IUPAC name of (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid (CID 20745982) is (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid.
What is the SMILES notation for (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid?
The canonical SMILES for (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid is CO[C@H]1CN(C(=O)O)C[C@H]1OC.
What is the InChIKey of (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid?
The InChIKey is PXCNTHIZLLJSKA-OLQVQODUSA-N. The full InChI is InChI=1S/C7H13NO4/c1-11-5-3-8(7(9)10)4-6(5)12-2/h5-6H,3-4H2,1-2H3,(H,9,10)/t5-,6+.
What are the key properties of (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid?
(3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid has a molecular weight of 175.18 g/mol, XLogP of 0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3,4-dimethoxypyrrolidine-1-carboxylic acid is sourced from PubChem (CID 20745982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).