2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid

C10H17NO6 — CID 103531253

IUPAC2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid
SMILESCOC1CN(C(=O)COCC(=O)O)CC1OC
InChIInChI=1S/C10H17NO6/c1-15-7-3-11(4-8(7)16-2)9(12)5-17-6-10(13)14/h7-8H,3-6H2,1-2H3,(H,13,14)
InChIKeyYQJJROGTWNSCGG-UHFFFAOYSA-N
MW247.25 g/mol
LogP-1.04
Rot. Bonds6

About 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid

2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid (PubChem CID 103531253) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid
PubChem CID103531253
Molecular FormulaC10H17NO6
Molecular Weight247.25 g/mol
Exact Mass247.11
IUPAC Name2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid
SMILESCOC1CN(C(=O)COCC(=O)O)CC1OC
InChIInChI=1S/C10H17NO6/c1-15-7-3-11(4-8(7)16-2)9(12)5-17-6-10(13)14/h7-8H,3-6H2,1-2H3,(H,13,14)
InChIKeyYQJJROGTWNSCGG-UHFFFAOYSA-N
XLogP-1.04
TPSA85.30 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 5-1.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid?
The IUPAC name of 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid (CID 103531253) is 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid.
What is the SMILES notation for 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid?
The canonical SMILES for 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid is COC1CN(C(=O)COCC(=O)O)CC1OC.
What is the InChIKey of 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid?
The InChIKey is YQJJROGTWNSCGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO6/c1-15-7-3-11(4-8(7)16-2)9(12)5-17-6-10(13)14/h7-8H,3-6H2,1-2H3,(H,13,14).
What are the key properties of 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid?
2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid has a molecular weight of 247.25 g/mol, XLogP of -1.04, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dimethoxypyrrolidin-1-yl)-2-oxoethoxy]acetic acid is sourced from PubChem (CID 103531253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).