C22H40N2O4 — CID 20583703
1-(3,4-diethylpyrrolidin-1-yl)-2-[2-[2-(3,4-diethylpyrrolidin-1-yl)-2-oxoethoxy]ethoxy]ethanone (PubChem CID 20583703) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is 1-(3,4-diethylpyrrolidin-1-yl)-2-[2-[2-(3,4-diethylpyrrolidin-1-yl)-2-oxoethoxy]ethoxy]ethanone.
| Compound Name | 1-(3,4-diethylpyrrolidin-1-yl)-2-[2-[2-(3,4-diethylpyrrolidin-1-yl)-2-oxoethoxy]ethoxy]ethanone |
|---|---|
| PubChem CID | 20583703 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 1-(3,4-diethylpyrrolidin-1-yl)-2-[2-[2-(3,4-diethylpyrrolidin-1-yl)-2-oxoethoxy]ethoxy]ethanone |
| SMILES | CCC1CN(C(=O)COCCOCC(=O)N2CC(CC)C(CC)C2)CC1CC |
| InChI | InChI=1S/C22H40N2O4/c1-5-17-11-23(12-18(17)6-2)21(25)15-27-9-10-28-16-22(26)24-13-19(7-3)20(8-4)14-24/h17-20H,5-16H2,1-4H3 |
| InChIKey | AZZDWXHJEZTZHN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|