C8H15NO3 — CID 89259810
1-(3,4-dimethoxypyrrolidin-1-yl)ethanone (PubChem CID 89259810) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 1-(3,4-dimethoxypyrrolidin-1-yl)ethanone.
| Compound Name | 1-(3,4-dimethoxypyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 89259810 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 1-(3,4-dimethoxypyrrolidin-1-yl)ethanone |
| SMILES | COC1CN(C(C)=O)CC1OC |
| InChI | InChI=1S/C8H15NO3/c1-6(10)9-4-7(11-2)8(5-9)12-3/h7-8H,4-5H2,1-3H3 |
| InChIKey | QNJVJXRHVJZEMK-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |