C6H10N4O3 — CID 137480598
(3S,4S)-3-azido-4-methoxypyrrolidine-1-carboxylic acid (PubChem CID 137480598) has the molecular formula C6H10N4O3 and a molecular weight of 186.17 g/mol. Its IUPAC name is (3S,4S)-3-azido-4-methoxypyrrolidine-1-carboxylic acid.
| Compound Name | (3S,4S)-3-azido-4-methoxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 137480598 |
| Molecular Formula | C6H10N4O3 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (3S,4S)-3-azido-4-methoxypyrrolidine-1-carboxylic acid |
| SMILES | CO[C@H]1CN(C(=O)O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C6H10N4O3/c1-13-5-3-10(6(11)12)2-4(5)8-9-7/h4-5H,2-3H2,1H3,(H,11,12)/t4-,5-/m0/s1 |
| InChIKey | KWYCHHCMSOWGMG-WHFBIAKZSA-N |
| XLogP | 0.67 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|