C13H20N4O3 — CID 59587918
tert-butyl (3S,4S)-3-azido-4-but-2-ynoxypyrrolidine-1-carboxylate (PubChem CID 59587918) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-azido-4-but-2-ynoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-azido-4-but-2-ynoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59587918 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | tert-butyl (3S,4S)-3-azido-4-but-2-ynoxypyrrolidine-1-carboxylate |
| SMILES | CC#CCO[C@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C13H20N4O3/c1-5-6-7-19-11-9-17(8-10(11)15-16-14)12(18)20-13(2,3)4/h10-11H,7-9H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | JUDUCBZYYVFILS-QWRGUYRKSA-N |
| XLogP | 2.32 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|