C18H25FN4O3 — CID 71524465
tert-butyl (3R,4R,6S)-3-azido-6-fluoro-4-phenylmethoxyazepane-1-carboxylate (PubChem CID 71524465) has the molecular formula C18H25FN4O3 and a molecular weight of 364.42 g/mol. Its IUPAC name is tert-butyl (3R,4R,6S)-3-azido-6-fluoro-4-phenylmethoxyazepane-1-carboxylate.
| Compound Name | tert-butyl (3R,4R,6S)-3-azido-6-fluoro-4-phenylmethoxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 71524465 |
| Molecular Formula | C18H25FN4O3 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl (3R,4R,6S)-3-azido-6-fluoro-4-phenylmethoxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@@H](OCc2ccccc2)[C@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C18H25FN4O3/c1-18(2,3)26-17(24)23-10-14(19)9-16(15(11-23)21-22-20)25-12-13-7-5-4-6-8-13/h4-8,14-16H,9-12H2,1-3H3/t14-,15+,16+/m0/s1 |
| InChIKey | XZAMFZMOHLMYST-ARFHVFGLSA-N |
| XLogP | 4.23 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|