C18H23F3N4O3 — CID 174214698
tert-butyl 3-azido-4-[[4-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate (PubChem CID 174214698) has the molecular formula C18H23F3N4O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is tert-butyl 3-azido-4-[[4-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-azido-4-[[4-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174214698 |
| Molecular Formula | C18H23F3N4O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | tert-butyl 3-azido-4-[[4-(trifluoromethyl)phenyl]methoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCc2ccc(C(F)(F)F)cc2)C(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C18H23F3N4O3/c1-17(2,3)28-16(26)25-9-8-15(14(10-25)23-24-22)27-11-12-4-6-13(7-5-12)18(19,20)21/h4-7,14-15H,8-11H2,1-3H3 |
| InChIKey | RLWDQYLZBHFZJN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|