C10H17N7O2 — CID 76541415
tert-butyl 3,4-diazidopiperidine-1-carboxylate (PubChem CID 76541415) has the molecular formula C10H17N7O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is tert-butyl 3,4-diazidopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3,4-diazidopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 76541415 |
| Molecular Formula | C10H17N7O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | tert-butyl 3,4-diazidopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N=[N+]=[N-])C(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C10H17N7O2/c1-10(2,3)19-9(18)17-5-4-7(13-15-11)8(6-17)14-16-12/h7-8H,4-6H2,1-3H3 |
| InChIKey | UWSARMGGOQMUQF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 127.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|