C23H27N5O2 — CID 131730338
tert-butyl (3R,4S)-3-azido-4-(benzhydrylideneamino)piperidine-1-carboxylate (PubChem CID 131730338) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-azido-4-(benzhydrylideneamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-azido-4-(benzhydrylideneamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131730338 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | tert-butyl (3R,4S)-3-azido-4-(benzhydrylideneamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](N=C(c2ccccc2)c2ccccc2)[C@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C23H27N5O2/c1-23(2,3)30-22(29)28-15-14-19(20(16-28)26-27-24)25-21(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,19-20H,14-16H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | ZCDUVROSTZEHFX-VQTJNVASSA-N |
| XLogP | 5.21 |
| TPSA | 90.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|